The reactions between CODPtCl2, COD = 1,5 cyclooctadiene, and the tin thiolate compounds (Ph)3Sn(SPh) and (Ph)2Sn(SPh)2 have been studied. Reaction between CODPtCl2 and (Ph)3Sn(SPh) yielded two new Pt-Sn heterobimetallic complexes depending on the CODPtCl2/(Ph)3Sn(SPh) molar ratio. For a 1:2 molar ratio, CODPt(SPh)2(Cl)Sn(Ph)3.2CH2Cl2, complex 1, was obtained, together with the homometallic complex CODPt(SPh)Cl.CH2Cl2. For a 1:1 molar ratio the complex formed was CODPt(SPh)(Cl)2Sn(Ph)3.3CH2Cl2, complex 2. Reaction with (Ph)2Sn(SPh)2 did not yielded any heterobimetallic complex, but rather CODPt(SPh)2.4CH2Cl2. The complexes were characterized by IR, ¹H-NMR, 13C-NMR, 195Pt-NMR, 119Sn-NMR and Mössabauer spectroscopies, elemental analysis and atomic absorption.
tin thiolates; oxidative addition; Pt-Sn heterobimetallics
